C15H26N4S — CID 130218791
(8S)-N,6,9-triethyl-8-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-2-carbothioamide (PubChem CID 130218791) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is (8S)-N,6,9-triethyl-8-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-2-carbothioamide.
| Compound Name | (8S)-N,6,9-triethyl-8-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-2-carbothioamide |
|---|---|
| PubChem CID | 130218791 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (8S)-N,6,9-triethyl-8-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-2-carbothioamide |
| SMILES | CCNC(=S)N1CCN2C(CC)=N[C@@H](C)C(CC)=C2C1 |
| InChI | InChI=1S/C15H26N4S/c1-5-12-11(4)17-14(6-2)19-9-8-18(10-13(12)19)15(20)16-7-3/h11H,5-10H2,1-4H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | UCPYFORBIDUFJD-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|