C12H21N3 — CID 130219119
(3S,6R)-N,N,1,3,4-pentamethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine (PubChem CID 130219119) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (3S,6R)-N,N,1,3,4-pentamethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine.
| Compound Name | (3S,6R)-N,N,1,3,4-pentamethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
|---|---|
| PubChem CID | 130219119 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (3S,6R)-N,N,1,3,4-pentamethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
| SMILES | CC1=N[C@@H](C)C(C)=C2C[C@@H](N(C)C)CN12 |
| InChI | InChI=1S/C12H21N3/c1-8-9(2)13-10(3)15-7-11(14(4)5)6-12(8)15/h9,11H,6-7H2,1-5H3/t9-,11+/m0/s1 |
| InChIKey | HNNLLAMXDZCAOJ-GXSJLCMTSA-N |
| XLogP | 1.72 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |