C10H17N3 — CID 130219181
(3S,6R)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine (PubChem CID 130219181) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (3S,6R)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine.
| Compound Name | (3S,6R)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
|---|---|
| PubChem CID | 130219181 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (3S,6R)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
| SMILES | CC1=N[C@@H](C)C(C)=C2C[C@@H](N)CN12 |
| InChI | InChI=1S/C10H17N3/c1-6-7(2)12-8(3)13-5-9(11)4-10(6)13/h7,9H,4-5,11H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | ZRAKSOBSCGTQIG-IONNQARKSA-N |
| XLogP | 1.11 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |