C12H19N3O — CID 130219191
(3S)-N,1,3,4-tetramethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-5-carboxamide (PubChem CID 130219191) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (3S)-N,1,3,4-tetramethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-5-carboxamide.
| Compound Name | (3S)-N,1,3,4-tetramethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 130219191 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (3S)-N,1,3,4-tetramethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-5-carboxamide |
| SMILES | CNC(=O)C1CCN2C(C)=N[C@@H](C)C(C)=C12 |
| InChI | InChI=1S/C12H19N3O/c1-7-8(2)14-9(3)15-6-5-10(11(7)15)12(16)13-4/h8,10H,5-6H2,1-4H3,(H,13,16)/t8-,10?/m0/s1 |
| InChIKey | JYOOOCMESOOVMG-PEHGTWAWSA-N |
| XLogP | 1.15 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |