C11H18N4 — CID 130219193
(3S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carboximidamide (PubChem CID 130219193) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is (3S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carboximidamide.
| Compound Name | (3S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carboximidamide |
|---|---|
| PubChem CID | 130219193 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (3S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carboximidamide |
| SMILES | [H]/N=C(\N)C1CC2=C(C)[C@H](C)N=C(C)N2C1 |
| InChI | InChI=1S/C11H18N4/c1-6-7(2)14-8(3)15-5-9(11(12)13)4-10(6)15/h7,9H,4-5H2,1-3H3,(H3,12,13)/t7-,9?/m0/s1 |
| InChIKey | HRULLXYLPYNOLF-JAVCKPHESA-N |
| XLogP | 1.34 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|