About (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol
(3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol (PubChem CID 130219321) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol.
Molecular Properties
| Compound Name | (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol |
| PubChem CID | 130219321 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol |
| SMILES | C=N[C@H](C)/C(C)=C/C(=C)S |
| InChI | InChI=1S/C8H13NS/c1-6(5-7(2)10)8(3)9-4/h5,8,10H,2,4H2,1,3H3/b6-5+/t8-/m1/s1 |
| InChIKey | ITCDEYGBOLGDAR-HQZHTGGTSA-N |
| XLogP | 2.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol?
The IUPAC name of (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol (CID 130219321) is (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol.
What is the SMILES notation for (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol?
The canonical SMILES for (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol is C=N[C@H](C)/C(C)=C/C(=C)S.
What is the InChIKey of (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol?
The InChIKey is ITCDEYGBOLGDAR-HQZHTGGTSA-N. The full InChI is InChI=1S/C8H13NS/c1-6(5-7(2)10)8(3)9-4/h5,8,10H,2,4H2,1,3H3/b6-5+/t8-/m1/s1.
What are the key properties of (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol?
(3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol has a molecular weight of 155.27 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5R)-4-methyl-5-(methylideneamino)hexa-1,3-diene-2-thiol is sourced from PubChem (CID 130219321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).