C9H13N3O2 — CID 130219534
3-methyl-N-(6-oxo-1H-pyrimidin-5-yl)butanamide (PubChem CID 130219534) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-methyl-N-(6-oxo-1H-pyrimidin-5-yl)butanamide.
| Compound Name | 3-methyl-N-(6-oxo-1H-pyrimidin-5-yl)butanamide |
|---|---|
| PubChem CID | 130219534 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-methyl-N-(6-oxo-1H-pyrimidin-5-yl)butanamide |
| SMILES | CC(C)CC(=O)Nc1cnc[nH]c1=O |
| InChI | InChI=1S/C9H13N3O2/c1-6(2)3-8(13)12-7-4-10-5-11-9(7)14/h4-6H,3H2,1-2H3,(H,12,13)(H,10,11,14) |
| InChIKey | TZFMZZJZHURRHT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |