About N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide
N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide (PubChem CID 130219577) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide.
Molecular Properties
| Compound Name | N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide |
| PubChem CID | 130219577 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide |
| SMILES | C=C(C)CCC(=O)N(C)C(CC)CN(C)C |
| InChI | InChI=1S/C13H26N2O/c1-7-12(10-14(4)5)15(6)13(16)9-8-11(2)3/h12H,2,7-10H2,1,3-6H3 |
| InChIKey | QJZYSXKVCVYRNP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide?
The IUPAC name of N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide (CID 130219577) is N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide.
What is the SMILES notation for N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide?
The canonical SMILES for N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide is C=C(C)CCC(=O)N(C)C(CC)CN(C)C.
What is the InChIKey of N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide?
The InChIKey is QJZYSXKVCVYRNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-7-12(10-14(4)5)15(6)13(16)9-8-11(2)3/h12H,2,7-10H2,1,3-6H3.
What are the key properties of N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide?
N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide has a molecular weight of 226.36 g/mol, XLogP of 2.14, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(dimethylamino)butan-2-yl]-N,4-dimethylpent-4-enamide is sourced from PubChem (CID 130219577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).