About bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate
bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate (PubChem CID 130219597) has the molecular formula C11H13FN2O4
and a molecular weight of 256.23 g/mol. Its IUPAC name is bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate.
Molecular Properties
| Compound Name | bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate |
| PubChem CID | 130219597 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate |
| SMILES | CCC(F)(C(=O)OCCC#N)C(=O)OCCC#N |
| InChI | InChI=1S/C11H13FN2O4/c1-2-11(12,9(15)17-7-3-5-13)10(16)18-8-4-6-14/h2-4,7-8H2,1H3 |
| InChIKey | WVGATTULUNLDRR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate?
The IUPAC name of bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate (CID 130219597) is bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate.
What is the SMILES notation for bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate?
The canonical SMILES for bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate is CCC(F)(C(=O)OCCC#N)C(=O)OCCC#N.
What is the InChIKey of bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate?
The InChIKey is WVGATTULUNLDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O4/c1-2-11(12,9(15)17-7-3-5-13)10(16)18-8-4-6-14/h2-4,7-8H2,1H3.
What are the key properties of bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate?
bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate has a molecular weight of 256.23 g/mol, XLogP of 1.02, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-cyanoethyl) 2-ethyl-2-fluoropropanedioate is sourced from PubChem (CID 130219597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).