About 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol
5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol (PubChem CID 130219609) has the molecular formula C17H16O2
and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol |
| PubChem CID | 130219609 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol |
| SMILES | Cc1cc(-c2ccc3c(c2)C=CC3O)cc(C)c1O |
| InChI | InChI=1S/C17H16O2/c1-10-7-14(8-11(2)17(10)19)12-3-5-15-13(9-12)4-6-16(15)18/h3-9,16,18-19H,1-2H3 |
| InChIKey | HHLPUKXUZYRJRJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol?
The IUPAC name of 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol (CID 130219609) is 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol.
What is the SMILES notation for 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol?
The canonical SMILES for 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol is Cc1cc(-c2ccc3c(c2)C=CC3O)cc(C)c1O.
What is the InChIKey of 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol?
The InChIKey is HHLPUKXUZYRJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2/c1-10-7-14(8-11(2)17(10)19)12-3-5-15-13(9-12)4-6-16(15)18/h3-9,16,18-19H,1-2H3.
What are the key properties of 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol?
5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol has a molecular weight of 252.31 g/mol, XLogP of 3.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxy-3,5-dimethylphenyl)-1H-inden-1-ol is sourced from PubChem (CID 130219609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).