C16H12BrClN2O3 — CID 1302199
(5S)-3-(3-bromophenyl)-N-(5-chloro-2-hydroxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 1302199) has the molecular formula C16H12BrClN2O3 and a molecular weight of 395.64 g/mol. Its IUPAC name is (5S)-3-(3-bromophenyl)-N-(5-chloro-2-hydroxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (5S)-3-(3-bromophenyl)-N-(5-chloro-2-hydroxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 1302199 |
| Molecular Formula | C16H12BrClN2O3 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | (5S)-3-(3-bromophenyl)-N-(5-chloro-2-hydroxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)[C@@H]1CC(c2cccc(Br)c2)=NO1 |
| InChI | InChI=1S/C16H12BrClN2O3/c17-10-3-1-2-9(6-10)12-8-15(23-20-12)16(22)19-13-7-11(18)4-5-14(13)21/h1-7,15,21H,8H2,(H,19,22)/t15-/m0/s1 |
| InChIKey | SYHWGTLLIIWVFX-HNNXBMFYSA-N |
| XLogP | 3.94 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|