C14H26N2 — CID 130220296
3-cyclobutyl-1,3,7-trimethyl-2,3a,4,5,6,7a-hexahydropyrrolo[2,3-b]pyridine (PubChem CID 130220296) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 3-cyclobutyl-1,3,7-trimethyl-2,3a,4,5,6,7a-hexahydropyrrolo[2,3-b]pyridine.
| Compound Name | 3-cyclobutyl-1,3,7-trimethyl-2,3a,4,5,6,7a-hexahydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 130220296 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 3-cyclobutyl-1,3,7-trimethyl-2,3a,4,5,6,7a-hexahydropyrrolo[2,3-b]pyridine |
| SMILES | CN1CCCC2C1N(C)CC2(C)C1CCC1 |
| InChI | InChI=1S/C14H26N2/c1-14(11-6-4-7-11)10-16(3)13-12(14)8-5-9-15(13)2/h11-13H,4-10H2,1-3H3 |
| InChIKey | JROZMNUAQBYPAE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |