About 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene
8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene (PubChem CID 130220365) has the molecular formula C18H29NO
and a molecular weight of 275.44 g/mol. Its IUPAC name is 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene.
Molecular Properties
| Compound Name | 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene |
| PubChem CID | 130220365 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene |
| SMILES | C/C=C\C1=C(/C=C\C)C2(CCN(C(C)(C)C)CC2)OC1 |
| InChI | InChI=1S/C18H29NO/c1-6-8-15-14-20-18(16(15)9-7-2)10-12-19(13-11-18)17(3,4)5/h6-9H,10-14H2,1-5H3/b8-6-,9-7- |
| InChIKey | MYRYNUZBRFDYMH-VRHVFUOLSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene?
The IUPAC name of 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene (CID 130220365) is 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene.
What is the SMILES notation for 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene?
The canonical SMILES for 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene is C/C=C\C1=C(/C=C\C)C2(CCN(C(C)(C)C)CC2)OC1.
What is the InChIKey of 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene?
The InChIKey is MYRYNUZBRFDYMH-VRHVFUOLSA-N. The full InChI is InChI=1S/C18H29NO/c1-6-8-15-14-20-18(16(15)9-7-2)10-12-19(13-11-18)17(3,4)5/h6-9H,10-14H2,1-5H3/b8-6-,9-7-.
What are the key properties of 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene?
8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene has a molecular weight of 275.44 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-3,4-bis[(Z)-prop-1-enyl]-1-oxa-8-azaspiro[4.5]dec-3-ene is sourced from PubChem (CID 130220365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).