About (1S)-3-methoxy-1,4-dimethyl-1H-indene
(1S)-3-methoxy-1,4-dimethyl-1H-indene (PubChem CID 130220443) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is (1S)-3-methoxy-1,4-dimethyl-1H-indene.
Molecular Properties
| Compound Name | (1S)-3-methoxy-1,4-dimethyl-1H-indene |
| PubChem CID | 130220443 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (1S)-3-methoxy-1,4-dimethyl-1H-indene |
| SMILES | COC1=C[C@H](C)c2cccc(C)c21 |
| InChI | InChI=1S/C12H14O/c1-8-5-4-6-10-9(2)7-11(13-3)12(8)10/h4-7,9H,1-3H3/t9-/m0/s1 |
| InChIKey | AHNUKHDCZIYSOX-VIFPVBQESA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-3-methoxy-1,4-dimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3-methoxy-1,4-dimethyl-1H-indene?
The IUPAC name of (1S)-3-methoxy-1,4-dimethyl-1H-indene (CID 130220443) is (1S)-3-methoxy-1,4-dimethyl-1H-indene.
What is the SMILES notation for (1S)-3-methoxy-1,4-dimethyl-1H-indene?
The canonical SMILES for (1S)-3-methoxy-1,4-dimethyl-1H-indene is COC1=C[C@H](C)c2cccc(C)c21.
What is the InChIKey of (1S)-3-methoxy-1,4-dimethyl-1H-indene?
The InChIKey is AHNUKHDCZIYSOX-VIFPVBQESA-N. The full InChI is InChI=1S/C12H14O/c1-8-5-4-6-10-9(2)7-11(13-3)12(8)10/h4-7,9H,1-3H3/t9-/m0/s1.
What are the key properties of (1S)-3-methoxy-1,4-dimethyl-1H-indene?
(1S)-3-methoxy-1,4-dimethyl-1H-indene has a molecular weight of 174.24 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3-methoxy-1,4-dimethyl-1H-indene is sourced from PubChem (CID 130220443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).