About 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile
1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile (PubChem CID 130220460) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile |
| PubChem CID | 130220460 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1cn(C2CO2)c2cnccc12 |
| InChI | InChI=1S/C10H7N3O/c11-3-7-5-13(10-6-14-10)9-4-12-2-1-8(7)9/h1-2,4-5,10H,6H2 |
| InChIKey | XPZXLXBLAKVQMW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile?
The IUPAC name of 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile (CID 130220460) is 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile.
What is the SMILES notation for 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile?
The canonical SMILES for 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile is N#Cc1cn(C2CO2)c2cnccc12.
What is the InChIKey of 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile?
The InChIKey is XPZXLXBLAKVQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O/c11-3-7-5-13(10-6-14-10)9-4-12-2-1-8(7)9/h1-2,4-5,10H,6H2.
What are the key properties of 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile?
1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile has a molecular weight of 185.19 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxiran-2-yl)pyrrolo[2,3-c]pyridine-3-carbonitrile is sourced from PubChem (CID 130220460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).