About 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine
1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 130220530) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine |
| PubChem CID | 130220530 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | C=CC1=C2C=CC=CN2C(NC)N1 |
| InChI | InChI=1S/C10H13N3/c1-3-8-9-6-4-5-7-13(9)10(11-2)12-8/h3-7,10-12H,1H2,2H3 |
| InChIKey | KGWKQAYATBMHJK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine?
The IUPAC name of 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine (CID 130220530) is 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine.
What is the SMILES notation for 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine?
The canonical SMILES for 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine is C=CC1=C2C=CC=CN2C(NC)N1.
What is the InChIKey of 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine?
The InChIKey is KGWKQAYATBMHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-3-8-9-6-4-5-7-13(9)10(11-2)12-8/h3-7,10-12H,1H2,2H3.
What are the key properties of 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine?
1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine has a molecular weight of 175.23 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-N-methyl-2,3-dihydroimidazo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 130220530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).