About 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione
6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione (PubChem CID 130220707) has the molecular formula C16H18F3N3O2
and a molecular weight of 341.33 g/mol. Its IUPAC name is 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione |
| PubChem CID | 130220707 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione |
| SMILES | CC(C)n1c(=O)n(CC2CC(F)(F)C2)c(=O)c2cc(N)c(F)cc21 |
| InChI | InChI=1S/C16H18F3N3O2/c1-8(2)22-13-4-11(17)12(20)3-10(13)14(23)21(15(22)24)7-9-5-16(18,19)6-9/h3-4,8-9H,5-7,20H2,1-2H3 |
| InChIKey | GVUXVMFSCJBBJY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione?
The IUPAC name of 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione (CID 130220707) is 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione.
What is the SMILES notation for 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione?
The canonical SMILES for 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione is CC(C)n1c(=O)n(CC2CC(F)(F)C2)c(=O)c2cc(N)c(F)cc21.
What is the InChIKey of 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione?
The InChIKey is GVUXVMFSCJBBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3N3O2/c1-8(2)22-13-4-11(17)12(20)3-10(13)14(23)21(15(22)24)7-9-5-16(18,19)6-9/h3-4,8-9H,5-7,20H2,1-2H3.
What are the key properties of 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione?
6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione has a molecular weight of 341.33 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-[(3,3-difluorocyclobutyl)methyl]-7-fluoro-1-propan-2-ylquinazoline-2,4-dione is sourced from PubChem (CID 130220707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).