C18H27N3 — CID 130220747
4-[(3E,5E)-6-ethenyl-7-ethyldodeca-1,3,5-trien-3-yl]-1,2,4-triazole (PubChem CID 130220747) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 4-[(3E,5E)-6-ethenyl-7-ethyldodeca-1,3,5-trien-3-yl]-1,2,4-triazole.
| Compound Name | 4-[(3E,5E)-6-ethenyl-7-ethyldodeca-1,3,5-trien-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 130220747 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 4-[(3E,5E)-6-ethenyl-7-ethyldodeca-1,3,5-trien-3-yl]-1,2,4-triazole |
| SMILES | C=C/C(=C\C=C(/C=C)n1cnnc1)C(CC)CCCCC |
| InChI | InChI=1S/C18H27N3/c1-5-9-10-11-16(6-2)17(7-3)12-13-18(8-4)21-14-19-20-15-21/h7-8,12-16H,3-6,9-11H2,1-2H3/b17-12+,18-13+ |
| InChIKey | YGYXSZQKYVRLJC-PWDIZTEBSA-N |
| XLogP | 5.02 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|