C14H23N3 — CID 130220821
(2Z,4E,6E)-1-N,1-N-bis(prop-2-enyl)octa-2,4,6-triene-1,5,7-triamine (PubChem CID 130220821) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (2Z,4E,6E)-1-N,1-N-bis(prop-2-enyl)octa-2,4,6-triene-1,5,7-triamine.
| Compound Name | (2Z,4E,6E)-1-N,1-N-bis(prop-2-enyl)octa-2,4,6-triene-1,5,7-triamine |
|---|---|
| PubChem CID | 130220821 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (2Z,4E,6E)-1-N,1-N-bis(prop-2-enyl)octa-2,4,6-triene-1,5,7-triamine |
| SMILES | C=CCN(CC=C)C/C=C\C=C(N)/C=C(\C)N |
| InChI | InChI=1S/C14H23N3/c1-4-9-17(10-5-2)11-7-6-8-14(16)12-13(3)15/h4-8,12H,1-2,9-11,15-16H2,3H3/b7-6-,13-12+,14-8+ |
| InChIKey | SFPRXJSKFZOOIL-ZEUGETGJSA-N |
| XLogP | 1.92 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|