C19H22OSi — CID 13022119
(2R,6S)-1,1-dimethyl-2,6-diphenylsilinan-4-one (PubChem CID 13022119) has the molecular formula C19H22OSi and a molecular weight of 294.47 g/mol. Its IUPAC name is (2R,6S)-1,1-dimethyl-2,6-diphenylsilinan-4-one.
| Compound Name | (2R,6S)-1,1-dimethyl-2,6-diphenylsilinan-4-one |
|---|---|
| PubChem CID | 13022119 |
| Molecular Formula | C19H22OSi |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (2R,6S)-1,1-dimethyl-2,6-diphenylsilinan-4-one |
| SMILES | C[Si]1(C)[C@@H](c2ccccc2)CC(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22OSi/c1-21(2)18(15-9-5-3-6-10-15)13-17(20)14-19(21)16-11-7-4-8-12-16/h3-12,18-19H,13-14H2,1-2H3/t18-,19+ |
| InChIKey | GWISOFZOPBFYKO-KDURUIRLSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|