About [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate
[2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate (PubChem CID 130222067) has the molecular formula C20H22BrNO4S
and a molecular weight of 452.37 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate.
Molecular Properties
| Compound Name | [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate |
| PubChem CID | 130222067 |
| Molecular Formula | C20H22BrNO4S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate |
| SMILES | O=C(CCCC1CCCCC1)Oc1ccc(/C=C2\SC(=O)NC2=O)cc1Br |
| InChI | InChI=1S/C20H22BrNO4S/c21-15-11-14(12-17-19(24)22-20(25)27-17)9-10-16(15)26-18(23)8-4-7-13-5-2-1-3-6-13/h9-13H,1-8H2,(H,22,24,25)/b17-12- |
| InChIKey | FXFGYJZVZFVZIH-ATVHPVEESA-N |
| XLogP | 5.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate?
The IUPAC name of [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate (CID 130222067) is [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate.
What is the SMILES notation for [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate?
The canonical SMILES for [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate is O=C(CCCC1CCCCC1)Oc1ccc(/C=C2\SC(=O)NC2=O)cc1Br.
What is the InChIKey of [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate?
The InChIKey is FXFGYJZVZFVZIH-ATVHPVEESA-N. The full InChI is InChI=1S/C20H22BrNO4S/c21-15-11-14(12-17-19(24)22-20(25)27-17)9-10-16(15)26-18(23)8-4-7-13-5-2-1-3-6-13/h9-13H,1-8H2,(H,22,24,25)/b17-12-.
What are the key properties of [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate?
[2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate has a molecular weight of 452.37 g/mol, XLogP of 5.43, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-cyclohexylbutanoate is sourced from PubChem (CID 130222067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).