About [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate
[2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate (PubChem CID 130222077) has the molecular formula C17H10BrNO4S
and a molecular weight of 404.24 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate.
Molecular Properties
| Compound Name | [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate |
| PubChem CID | 130222077 |
| Molecular Formula | C17H10BrNO4S |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(OC(=O)c3ccccc3)c(Br)c2)S1 |
| InChI | InChI=1S/C17H10BrNO4S/c18-12-8-10(9-14-15(20)19-17(22)24-14)6-7-13(12)23-16(21)11-4-2-1-3-5-11/h1-9H,(H,19,20,22)/b14-9- |
| InChIKey | YZGFIEXJSYJXAP-ZROIWOOFSA-N |
| XLogP | 3.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate?
The IUPAC name of [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate (CID 130222077) is [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate.
What is the SMILES notation for [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate?
The canonical SMILES for [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate is O=C1NC(=O)/C(=C/c2ccc(OC(=O)c3ccccc3)c(Br)c2)S1.
What is the InChIKey of [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate?
The InChIKey is YZGFIEXJSYJXAP-ZROIWOOFSA-N. The full InChI is InChI=1S/C17H10BrNO4S/c18-12-8-10(9-14-15(20)19-17(22)24-14)6-7-13(12)23-16(21)11-4-2-1-3-5-11/h1-9H,(H,19,20,22)/b14-9-.
What are the key properties of [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate?
[2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate has a molecular weight of 404.24 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] benzoate is sourced from PubChem (CID 130222077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).