About 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine
2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 130222584) has the molecular formula C10H6Cl2N2S
and a molecular weight of 257.15 g/mol. Its IUPAC name is 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine |
| PubChem CID | 130222584 |
| Molecular Formula | C10H6Cl2N2S |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | ClC1=NC(Cl)C2Sc3ccccc3C2=N1 |
| InChI | InChI=1S/C10H6Cl2N2S/c11-9-8-7(13-10(12)14-9)5-3-1-2-4-6(5)15-8/h1-4,8-9H |
| InChIKey | YCICPWFDUSOQIZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine?
The IUPAC name of 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine (CID 130222584) is 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine.
What is the SMILES notation for 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine?
The canonical SMILES for 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine is ClC1=NC(Cl)C2Sc3ccccc3C2=N1.
What is the InChIKey of 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine?
The InChIKey is YCICPWFDUSOQIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2S/c11-9-8-7(13-10(12)14-9)5-3-1-2-4-6(5)15-8/h1-4,8-9H.
What are the key properties of 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine?
2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine has a molecular weight of 257.15 g/mol, XLogP of 3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-4,4a-dihydro-[1]benzothiolo[3,2-d]pyrimidine is sourced from PubChem (CID 130222584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).