C18H19NO4S — CID 130222606
[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-cyclopentylpropanoate (PubChem CID 130222606) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-cyclopentylpropanoate.
| Compound Name | [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 130222606 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-cyclopentylpropanoate |
| SMILES | O=C(CCC1CCCC1)Oc1ccc(/C=C2\SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H19NO4S/c20-16(10-7-12-3-1-2-4-12)23-14-8-5-13(6-9-14)11-15-17(21)19-18(22)24-15/h5-6,8-9,11-12H,1-4,7,10H2,(H,19,21,22)/b15-11- |
| InChIKey | NYINVPPLWCDGHO-PTNGSMBKSA-N |
| XLogP | 3.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|