C14H18Br2 — CID 13022290
4,9-dibromopentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 13022290) has the molecular formula C14H18Br2 and a molecular weight of 346.11 g/mol. Its IUPAC name is 4,9-dibromopentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | 4,9-dibromopentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 13022290 |
| Molecular Formula | C14H18Br2 |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 4,9-dibromopentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | BrC12CC3C4CC5(Br)CC3C(C1)C(C5)C4C2 |
| InChI | InChI=1S/C14H18Br2/c15-13-1-7-8-4-14(16)5-9(7)11(3-13)12(6-14)10(8)2-13/h7-12H,1-6H2 |
| InChIKey | WCWJFEOCGGICSA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|