About pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid
pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid (PubChem CID 13022294) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid.
Analyze pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid?
The IUPAC name of pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid (CID 13022294) is pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid.
What is the SMILES notation for pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid?
The canonical SMILES for pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid is O=C(O)C12CC3C4CC5(C(=O)O)CC3C(C1)C(C5)C4C2.
What is the InChIKey of pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid?
The InChIKey is NITPEEZLMYVWDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O4/c17-13(18)15-1-7-8-4-16(14(19)20)5-9(7)11(3-15)12(6-16)10(8)2-15/h7-12H,1-6H2,(H,17,18)(H,19,20).
What are the key properties of pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid?
pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid has a molecular weight of 276.33 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-dicarboxylic acid is sourced from PubChem (CID 13022294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).