C21H36O — CID 130223219
1-propan-2-yl-3-(5,8,8-trimethylnonan-2-yloxy)benzene (PubChem CID 130223219) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-propan-2-yl-3-(5,8,8-trimethylnonan-2-yloxy)benzene.
| Compound Name | 1-propan-2-yl-3-(5,8,8-trimethylnonan-2-yloxy)benzene |
|---|---|
| PubChem CID | 130223219 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 1-propan-2-yl-3-(5,8,8-trimethylnonan-2-yloxy)benzene |
| SMILES | CC(CCC(C)Oc1cccc(C(C)C)c1)CCC(C)(C)C |
| InChI | InChI=1S/C21H36O/c1-16(2)19-9-8-10-20(15-19)22-18(4)12-11-17(3)13-14-21(5,6)7/h8-10,15-18H,11-14H2,1-7H3 |
| InChIKey | QONWWURGFLJGCL-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |