About (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine
(6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine (PubChem CID 130223762) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine.
Molecular Properties
| Compound Name | (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine |
| PubChem CID | 130223762 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine |
| SMILES | CCC(C)C1=C[C@@H](C)SC(C)=N1 |
| InChI | InChI=1S/C10H17NS/c1-5-7(2)10-6-8(3)12-9(4)11-10/h6-8H,5H2,1-4H3/t7?,8-/m1/s1 |
| InChIKey | DDHYKJZBCSFBQU-BRFYHDHCSA-N |
| XLogP | 3.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine?
The IUPAC name of (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine (CID 130223762) is (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine.
What is the SMILES notation for (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine?
The canonical SMILES for (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine is CCC(C)C1=C[C@@H](C)SC(C)=N1.
What is the InChIKey of (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine?
The InChIKey is DDHYKJZBCSFBQU-BRFYHDHCSA-N. The full InChI is InChI=1S/C10H17NS/c1-5-7(2)10-6-8(3)12-9(4)11-10/h6-8H,5H2,1-4H3/t7?,8-/m1/s1.
What are the key properties of (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine?
(6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine has a molecular weight of 183.32 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4-butan-2-yl-2,6-dimethyl-6H-1,3-thiazine is sourced from PubChem (CID 130223762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).