C16H26O — CID 130224186
1-butan-2-yl-3-(2,3-dimethylbutoxy)benzene (PubChem CID 130224186) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-butan-2-yl-3-(2,3-dimethylbutoxy)benzene.
| Compound Name | 1-butan-2-yl-3-(2,3-dimethylbutoxy)benzene |
|---|---|
| PubChem CID | 130224186 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-butan-2-yl-3-(2,3-dimethylbutoxy)benzene |
| SMILES | CCC(C)c1cccc(OCC(C)C(C)C)c1 |
| InChI | InChI=1S/C16H26O/c1-6-13(4)15-8-7-9-16(10-15)17-11-14(5)12(2)3/h7-10,12-14H,6,11H2,1-5H3 |
| InChIKey | PXGDTPGYRIUCSG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |