C48H79N — CID 13022426
(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-N-prop-2-enylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaen-1-amine (PubChem CID 13022426) has the molecular formula C48H79N and a molecular weight of 670.17 g/mol. Its IUPAC name is (2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-N-prop-2-enylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaen-1-amine.
| Compound Name | (2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-N-prop-2-enylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaen-1-amine |
|---|---|
| PubChem CID | 13022426 |
| Molecular Formula | C48H79N |
| Molecular Weight | 670.17 g/mol |
| Exact Mass | 669.62 |
| IUPAC Name | (2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethyl-N-prop-2-enylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaen-1-amine |
| SMILES | C=CCNC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C48H79N/c1-12-38-49-39-37-48(11)36-20-35-47(10)34-19-33-46(9)32-18-31-45(8)30-17-29-44(7)28-16-27-43(6)26-15-25-42(5)24-14-23-41(4)22-13-21-40(2)3/h12,21,23,25,27,29,31,33,35,37,49H,1,13-20,22,24,26,28,30,32,34,36,38-39H2,2-11H3/b41-23+,42-25+,43-27+,44-29+,45-31+,46-33+,47-35+,48-37+ |
| InChIKey | XGMBEUSCHZFBHY-IQSNHBBHSA-N |
| XLogP | 15.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.17 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|