About (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane
(4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane (PubChem CID 130224363) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane |
| PubChem CID | 130224363 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane |
| SMILES | C[C@@H]1CCN(C)C12CCOC2 |
| InChI | InChI=1S/C9H17NO/c1-8-3-5-10(2)9(8)4-6-11-7-9/h8H,3-7H2,1-2H3/t8-,9?/m1/s1 |
| InChIKey | PSRXVEQFXDEACN-VEDVMXKPSA-N |
| XLogP | 1.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane?
The IUPAC name of (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane (CID 130224363) is (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane.
What is the SMILES notation for (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane?
The canonical SMILES for (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane is C[C@@H]1CCN(C)C12CCOC2.
What is the InChIKey of (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane?
The InChIKey is PSRXVEQFXDEACN-VEDVMXKPSA-N. The full InChI is InChI=1S/C9H17NO/c1-8-3-5-10(2)9(8)4-6-11-7-9/h8H,3-7H2,1-2H3/t8-,9?/m1/s1.
What are the key properties of (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane?
(4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane has a molecular weight of 155.24 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,4-dimethyl-7-oxa-1-azaspiro[4.4]nonane is sourced from PubChem (CID 130224363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).