C11H18INO — CID 130225061
(1Z,3Z,5E)-5-(2-iodopropoxy)-2-methylhepta-1,3,5-trien-1-amine (PubChem CID 130225061) has the molecular formula C11H18INO and a molecular weight of 307.18 g/mol. Its IUPAC name is (1Z,3Z,5E)-5-(2-iodopropoxy)-2-methylhepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z,5E)-5-(2-iodopropoxy)-2-methylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 130225061 |
| Molecular Formula | C11H18INO |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (1Z,3Z,5E)-5-(2-iodopropoxy)-2-methylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C(\C=C/C(C)=C\N)OCC(C)I |
| InChI | InChI=1S/C11H18INO/c1-4-11(14-8-10(3)12)6-5-9(2)7-13/h4-7,10H,8,13H2,1-3H3/b6-5-,9-7-,11-4+ |
| InChIKey | VCZWHACTRJMAKP-JOYFPLKLSA-N |
| XLogP | 3.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|