About (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine
(6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine (PubChem CID 130225265) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine.
Molecular Properties
| Compound Name | (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine |
| PubChem CID | 130225265 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine |
| SMILES | CC(C)C1=C[C@H](C)SC=N1 |
| InChI | InChI=1S/C8H13NS/c1-6(2)8-4-7(3)10-5-9-8/h4-7H,1-3H3/t7-/m0/s1 |
| InChIKey | DKNDVJBGZOZVDV-ZETCQYMHSA-N |
| XLogP | 2.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine?
The IUPAC name of (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine (CID 130225265) is (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine.
What is the SMILES notation for (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine?
The canonical SMILES for (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine is CC(C)C1=C[C@H](C)SC=N1.
What is the InChIKey of (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine?
The InChIKey is DKNDVJBGZOZVDV-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13NS/c1-6(2)8-4-7(3)10-5-9-8/h4-7H,1-3H3/t7-/m0/s1.
What are the key properties of (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine?
(6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine has a molecular weight of 155.27 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-methyl-4-propan-2-yl-6H-1,3-thiazine is sourced from PubChem (CID 130225265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).