C23H30FN — CID 130225746
(4Z,5Z,8Z,9Z)-4,8-di(ethylidene)-N-[(3-fluorophenyl)methyl]-N-methylundeca-1,5,9-trien-2-amine (PubChem CID 130225746) has the molecular formula C23H30FN and a molecular weight of 339.50 g/mol. Its IUPAC name is (4Z,5Z,8Z,9Z)-4,8-di(ethylidene)-N-[(3-fluorophenyl)methyl]-N-methylundeca-1,5,9-trien-2-amine.
| Compound Name | (4Z,5Z,8Z,9Z)-4,8-di(ethylidene)-N-[(3-fluorophenyl)methyl]-N-methylundeca-1,5,9-trien-2-amine |
|---|---|
| PubChem CID | 130225746 |
| Molecular Formula | C23H30FN |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | (4Z,5Z,8Z,9Z)-4,8-di(ethylidene)-N-[(3-fluorophenyl)methyl]-N-methylundeca-1,5,9-trien-2-amine |
| SMILES | C=C(CC(/C=C\CC(/C=C\C)=C/C)=C/C)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C23H30FN/c1-6-11-20(7-2)12-9-13-21(8-3)16-19(4)25(5)18-22-14-10-15-23(24)17-22/h6-11,13-15,17H,4,12,16,18H2,1-3,5H3/b11-6-,13-9-,20-7+,21-8+ |
| InChIKey | SLHHLPUOCMTBFA-LYASOVIOSA-N |
| XLogP | 6.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|