C24H42N2O9 — CID 130226217
2-[(4-carboxy-2,2,4-trimethylpentanoyl)amino]-6-methyl-5-oxo-6-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]octanoic acid (PubChem CID 130226217) has the molecular formula C24H42N2O9 and a molecular weight of 502.61 g/mol. Its IUPAC name is 2-[(4-carboxy-2,2,4-trimethylpentanoyl)amino]-6-methyl-5-oxo-6-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]octanoic acid.
| Compound Name | 2-[(4-carboxy-2,2,4-trimethylpentanoyl)amino]-6-methyl-5-oxo-6-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]octanoic acid |
|---|---|
| PubChem CID | 130226217 |
| Molecular Formula | C24H42N2O9 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 2-[(4-carboxy-2,2,4-trimethylpentanoyl)amino]-6-methyl-5-oxo-6-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]octanoic acid |
| SMILES | CCC(C)(NCCOCCOCC=O)C(=O)CCC(NC(=O)C(C)(C)CC(C)(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H42N2O9/c1-7-24(6,25-10-12-34-14-15-35-13-11-27)18(28)9-8-17(19(29)30)26-20(31)22(2,3)16-23(4,5)21(32)33/h11,17,25H,7-10,12-16H2,1-6H3,(H,26,31)(H,29,30)(H,32,33) |
| InChIKey | LNCYDSMVGJCFJV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|