C18H18ClN5O4S — CID 130226370
methyl 2-chloro-5-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]amino]methyl]benzoate (PubChem CID 130226370) has the molecular formula C18H18ClN5O4S and a molecular weight of 435.89 g/mol. Its IUPAC name is methyl 2-chloro-5-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]amino]methyl]benzoate.
| Compound Name | methyl 2-chloro-5-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 130226370 |
| Molecular Formula | C18H18ClN5O4S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | methyl 2-chloro-5-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1cc(CNc2nccn3c([C@@H]4SC[C@@H](O)[C@H]4O)nnc23)ccc1Cl |
| InChI | InChI=1S/C18H18ClN5O4S/c1-28-18(27)10-6-9(2-3-11(10)19)7-21-15-17-23-22-16(24(17)5-4-20-15)14-13(26)12(25)8-29-14/h2-6,12-14,25-26H,7-8H2,1H3,(H,20,21)/t12-,13-,14-/m1/s1 |
| InChIKey | KEXZMWAICRHOCQ-MGPQQGTHSA-N |
| XLogP | 1.69 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |