C14H15N5O2S2 — CID 130226397
(2S,3R,4S)-2-[8-(thiophen-3-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]thiolane-3,4-diol (PubChem CID 130226397) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is (2S,3R,4S)-2-[8-(thiophen-3-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]thiolane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[8-(thiophen-3-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 130226397 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (2S,3R,4S)-2-[8-(thiophen-3-ylmethylamino)-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]thiolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)CS[C@H]1c1nnc2c(NCc3ccsc3)nccn12 |
| InChI | InChI=1S/C14H15N5O2S2/c20-9-7-23-11(10(9)21)13-17-18-14-12(15-2-3-19(13)14)16-5-8-1-4-22-6-8/h1-4,6,9-11,20-21H,5,7H2,(H,15,16)/t9-,10-,11-/m1/s1 |
| InChIKey | HDCOXGQBTYVLCC-GMTAPVOTSA-N |
| XLogP | 1.31 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |