C18H19FN6O3S — CID 130226399
4-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]amino]methyl]-2-fluoro-N-methylbenzamide (PubChem CID 130226399) has the molecular formula C18H19FN6O3S and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]amino]methyl]-2-fluoro-N-methylbenzamide.
| Compound Name | 4-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]amino]methyl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 130226399 |
| Molecular Formula | C18H19FN6O3S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-[[[3-[(2S,3R,4S)-3,4-dihydroxythiolan-2-yl]-[1,2,4]triazolo[4,3-a]pyrazin-8-yl]amino]methyl]-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CNc2nccn3c([C@@H]4SC[C@@H](O)[C@H]4O)nnc23)cc1F |
| InChI | InChI=1S/C18H19FN6O3S/c1-20-18(28)10-3-2-9(6-11(10)19)7-22-15-17-24-23-16(25(17)5-4-21-15)14-13(27)12(26)8-29-14/h2-6,12-14,26-27H,7-8H2,1H3,(H,20,28)(H,21,22)/t12-,13-,14-/m1/s1 |
| InChIKey | ACCCIQFCFHNFSW-MGPQQGTHSA-N |
| XLogP | 0.74 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |