C16H15ClFN5O2S — CID 130226432
(2S,3R,4S)-2-[8-[(3-chloro-5-fluorophenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]thiolane-3,4-diol (PubChem CID 130226432) has the molecular formula C16H15ClFN5O2S and a molecular weight of 395.85 g/mol. Its IUPAC name is (2S,3R,4S)-2-[8-[(3-chloro-5-fluorophenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]thiolane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[8-[(3-chloro-5-fluorophenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 130226432 |
| Molecular Formula | C16H15ClFN5O2S |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | (2S,3R,4S)-2-[8-[(3-chloro-5-fluorophenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]thiolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)CS[C@H]1c1nnc2c(NCc3cc(F)cc(Cl)c3)nccn12 |
| InChI | InChI=1S/C16H15ClFN5O2S/c17-9-3-8(4-10(18)5-9)6-20-14-16-22-21-15(23(16)2-1-19-14)13-12(25)11(24)7-26-13/h1-5,11-13,24-25H,6-7H2,(H,19,20)/t11-,12-,13-/m1/s1 |
| InChIKey | HUUYJDWEXSCWLO-JHJVBQTASA-N |
| XLogP | 2.04 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |