C17H16Cl2N4O2S — CID 130226517
(2S,3R,4S)-2-[8-[(2,4-dichlorophenyl)methylamino]imidazo[1,2-a]pyrazin-3-yl]thiolane-3,4-diol (PubChem CID 130226517) has the molecular formula C17H16Cl2N4O2S and a molecular weight of 411.31 g/mol. Its IUPAC name is (2S,3R,4S)-2-[8-[(2,4-dichlorophenyl)methylamino]imidazo[1,2-a]pyrazin-3-yl]thiolane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[8-[(2,4-dichlorophenyl)methylamino]imidazo[1,2-a]pyrazin-3-yl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 130226517 |
| Molecular Formula | C17H16Cl2N4O2S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (2S,3R,4S)-2-[8-[(2,4-dichlorophenyl)methylamino]imidazo[1,2-a]pyrazin-3-yl]thiolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)CS[C@H]1c1cnc2c(NCc3ccc(Cl)cc3Cl)nccn12 |
| InChI | InChI=1S/C17H16Cl2N4O2S/c18-10-2-1-9(11(19)5-10)6-21-16-17-22-7-12(23(17)4-3-20-16)15-14(25)13(24)8-26-15/h1-5,7,13-15,24-25H,6,8H2,(H,20,21)/t13-,14-,15+/m1/s1 |
| InChIKey | TWENHYCIBZTPBV-KFWWJZLASA-N |
| XLogP | 3.16 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |