C17H17Cl2N5O2 — CID 130226769
(1R,2S,3S)-3-[8-[(3,5-dichlorophenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]cyclopentane-1,2-diol (PubChem CID 130226769) has the molecular formula C17H17Cl2N5O2 and a molecular weight of 394.26 g/mol. Its IUPAC name is (1R,2S,3S)-3-[8-[(3,5-dichlorophenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3S)-3-[8-[(3,5-dichlorophenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 130226769 |
| Molecular Formula | C17H17Cl2N5O2 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (1R,2S,3S)-3-[8-[(3,5-dichlorophenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]cyclopentane-1,2-diol |
| SMILES | O[C@@H]1[C@H](O)CC[C@H]1c1nnc2c(NCc3cc(Cl)cc(Cl)c3)nccn12 |
| InChI | InChI=1S/C17H17Cl2N5O2/c18-10-5-9(6-11(19)7-10)8-21-15-17-23-22-16(24(17)4-3-20-15)12-1-2-13(25)14(12)26/h3-7,12-14,25-26H,1-2,8H2,(H,20,21)/t12-,13-,14+/m1/s1 |
| InChIKey | QWEDVDMDABEDOR-MCIONIFRSA-N |
| XLogP | 2.64 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |