C13H16ClN3O3S — CID 130226852
1-[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-2-[(3-chloropyrazin-2-yl)amino]ethanone (PubChem CID 130226852) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-2-[(3-chloropyrazin-2-yl)amino]ethanone.
| Compound Name | 1-[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-2-[(3-chloropyrazin-2-yl)amino]ethanone |
|---|---|
| PubChem CID | 130226852 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]-2-[(3-chloropyrazin-2-yl)amino]ethanone |
| SMILES | CC1(C)O[C@@H]2[C@@H](CS[C@H]2C(=O)CNc2nccnc2Cl)O1 |
| InChI | InChI=1S/C13H16ClN3O3S/c1-13(2)19-8-6-21-10(9(8)20-13)7(18)5-17-12-11(14)15-3-4-16-12/h3-4,8-10H,5-6H2,1-2H3,(H,16,17)/t8-,9-,10+/m1/s1 |
| InChIKey | YMIOJYXJIFGITQ-BBBLOLIVSA-N |
| XLogP | 1.75 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |