About 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene
1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene (PubChem CID 130227013) has the molecular formula C24H17BrF2O2
and a molecular weight of 455.30 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene.
Molecular Properties
| Compound Name | 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene |
| PubChem CID | 130227013 |
| Molecular Formula | C24H17BrF2O2 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene |
| SMILES | COc1c(OC)c(-c2cc(Br)ccc2F)c2ccccc2c1-c1ccccc1F |
| InChI | InChI=1S/C24H17BrF2O2/c1-28-23-21(17-9-5-6-10-19(17)26)15-7-3-4-8-16(15)22(24(23)29-2)18-13-14(25)11-12-20(18)27/h3-13H,1-2H3 |
| InChIKey | HLZPBPLRIZFHHL-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene?
The IUPAC name of 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene (CID 130227013) is 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene.
What is the SMILES notation for 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene?
The canonical SMILES for 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene is COc1c(OC)c(-c2cc(Br)ccc2F)c2ccccc2c1-c1ccccc1F.
What is the InChIKey of 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene?
The InChIKey is HLZPBPLRIZFHHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17BrF2O2/c1-28-23-21(17-9-5-6-10-19(17)26)15-7-3-4-8-16(15)22(24(23)29-2)18-13-14(25)11-12-20(18)27/h3-13H,1-2H3.
What are the key properties of 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene?
1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene has a molecular weight of 455.30 g/mol, XLogP of 7.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2-fluorophenyl)-4-(2-fluorophenyl)-2,3-dimethoxynaphthalene is sourced from PubChem (CID 130227013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).