C39H42N12O2 — CID 130227080
4-[2-[[4-[4-[4-amino-6-(4-phenoxyanilino)-1,3,5-triazin-2-yl]-2-benzylpiperazin-1-yl]-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl]phenol (PubChem CID 130227080) has the molecular formula C39H42N12O2 and a molecular weight of 710.85 g/mol. Its IUPAC name is 4-[2-[[4-[4-[4-amino-6-(4-phenoxyanilino)-1,3,5-triazin-2-yl]-2-benzylpiperazin-1-yl]-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-[4-[4-amino-6-(4-phenoxyanilino)-1,3,5-triazin-2-yl]-2-benzylpiperazin-1-yl]-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 130227080 |
| Molecular Formula | C39H42N12O2 |
| Molecular Weight | 710.85 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | 4-[2-[[4-[4-[4-amino-6-(4-phenoxyanilino)-1,3,5-triazin-2-yl]-2-benzylpiperazin-1-yl]-6-(ethylamino)-1,3,5-triazin-2-yl]amino]ethyl]phenol |
| SMILES | CCNc1nc(NCCc2ccc(O)cc2)nc(N2CCN(c3nc(N)nc(Nc4ccc(Oc5ccccc5)cc4)n3)CC2Cc2ccccc2)n1 |
| InChI | InChI=1S/C39H42N12O2/c1-2-41-35-46-36(42-22-21-27-13-17-31(52)18-14-27)48-39(47-35)51-24-23-50(26-30(51)25-28-9-5-3-6-10-28)38-45-34(40)44-37(49-38)43-29-15-19-33(20-16-29)53-32-11-7-4-8-12-32/h3-20,30,52H,2,21-26H2,1H3,(H3,40,43,44,45,49)(H2,41,42,46,47,48) |
| InChIKey | BUPHVDMSFUCANI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 175.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.85 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |