C16H33N7O3 — CID 130227087
(2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[methyl-(1-methylpyrrolidin-3-yl)amino]methyl]oxolane-3,4-diol (PubChem CID 130227087) has the molecular formula C16H33N7O3 and a molecular weight of 371.49 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[methyl-(1-methylpyrrolidin-3-yl)amino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[methyl-(1-methylpyrrolidin-3-yl)amino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130227087 |
| Molecular Formula | C16H33N7O3 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[methyl-(1-methylpyrrolidin-3-yl)amino]methyl]oxolane-3,4-diol |
| SMILES | CN1CCC(N(C)C[C@H]2O[C@@H](N3CNC4C(N)NCNC43)[C@H](O)[C@@H]2O)C1 |
| InChI | InChI=1S/C16H33N7O3/c1-21-4-3-9(5-21)22(2)6-10-12(24)13(25)16(26-10)23-8-20-11-14(17)18-7-19-15(11)23/h9-16,18-20,24-25H,3-8,17H2,1-2H3/t9?,10-,11?,12-,13-,14?,15?,16-/m1/s1 |
| InChIKey | KVZXYZDODCGQEM-PKMWQTOPSA-N |
| XLogP | -3.94 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |