C18H32N8O3 — CID 130227427
(2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[methyl-[2-(pyridin-2-ylamino)ethyl]amino]methyl]oxolane-3,4-diol (PubChem CID 130227427) has the molecular formula C18H32N8O3 and a molecular weight of 408.51 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[methyl-[2-(pyridin-2-ylamino)ethyl]amino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[methyl-[2-(pyridin-2-ylamino)ethyl]amino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130227427 |
| Molecular Formula | C18H32N8O3 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[methyl-[2-(pyridin-2-ylamino)ethyl]amino]methyl]oxolane-3,4-diol |
| SMILES | CN(CCNc1ccccn1)C[C@H]1O[C@@H](N2CNC3C(N)NCNC32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H32N8O3/c1-25(7-6-21-12-4-2-3-5-20-12)8-11-14(27)15(28)18(29-11)26-10-24-13-16(19)22-9-23-17(13)26/h2-5,11,13-18,22-24,27-28H,6-10,19H2,1H3,(H,20,21)/t11-,13?,14-,15-,16?,17?,18-/m1/s1 |
| InChIKey | VEQNLYQWIKPBOF-ZEOAGGGBSA-N |
| XLogP | -3.14 |
| TPSA | 143.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |