C24H36N8O6 — CID 130228153
1-[3-[[(3S,4R)-5-(7-amino-2,3a,4,5,7,7a-hexahydro-1H-imidazo[4,5-d][1,3]oxazin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[3-(1,3-oxazol-5-yl)phenyl]urea (PubChem CID 130228153) has the molecular formula C24H36N8O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is 1-[3-[[(3S,4R)-5-(7-amino-2,3a,4,5,7,7a-hexahydro-1H-imidazo[4,5-d][1,3]oxazin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[3-(1,3-oxazol-5-yl)phenyl]urea.
| Compound Name | 1-[3-[[(3S,4R)-5-(7-amino-2,3a,4,5,7,7a-hexahydro-1H-imidazo[4,5-d][1,3]oxazin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[3-(1,3-oxazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 130228153 |
| Molecular Formula | C24H36N8O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 1-[3-[[(3S,4R)-5-(7-amino-2,3a,4,5,7,7a-hexahydro-1H-imidazo[4,5-d][1,3]oxazin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[3-(1,3-oxazol-5-yl)phenyl]urea |
| SMILES | CN(CCCNC(=O)Nc1cccc(-c2cnco2)c1)CC1OC(N2CNC3C(N)OCNC32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H36N8O6/c1-31(7-3-6-27-24(35)30-15-5-2-4-14(8-15)16-9-26-12-36-16)10-17-19(33)20(34)23(38-17)32-11-28-18-21(25)37-13-29-22(18)32/h2,4-5,8-9,12,17-23,28-29,33-34H,3,6-7,10-11,13,25H2,1H3,(H2,27,30,35)/t17?,18?,19-,20-,21?,22?,23?/m1/s1 |
| InChIKey | GKUILSIOTPLDKO-IDRJGSRKSA-N |
| XLogP | -1.35 |
| TPSA | 182.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|