C22H20FN5O3 — CID 130228264
4-[4-(6-fluoro-2-oxo-1H-quinolin-3-yl)triazol-1-yl]-N-(2-methoxyethyl)-N-methylbenzamide (PubChem CID 130228264) has the molecular formula C22H20FN5O3 and a molecular weight of 421.43 g/mol. Its IUPAC name is 4-[4-(6-fluoro-2-oxo-1H-quinolin-3-yl)triazol-1-yl]-N-(2-methoxyethyl)-N-methylbenzamide.
| Compound Name | 4-[4-(6-fluoro-2-oxo-1H-quinolin-3-yl)triazol-1-yl]-N-(2-methoxyethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 130228264 |
| Molecular Formula | C22H20FN5O3 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-[4-(6-fluoro-2-oxo-1H-quinolin-3-yl)triazol-1-yl]-N-(2-methoxyethyl)-N-methylbenzamide |
| SMILES | COCCN(C)C(=O)c1ccc(-n2cc(-c3cc4cc(F)ccc4[nH]c3=O)nn2)cc1 |
| InChI | InChI=1S/C22H20FN5O3/c1-27(9-10-31-2)22(30)14-3-6-17(7-4-14)28-13-20(25-26-28)18-12-15-11-16(23)5-8-19(15)24-21(18)29/h3-8,11-13H,9-10H2,1-2H3,(H,24,29) |
| InChIKey | NUMBSDPYRZQZLK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |