C23H20F3N5O — CID 130229064
(3R)-3-methyl-4-[5-methyl-8-(1H-pyrazol-5-yl)-4-(2,3,5-trifluorophenyl)-1,7-naphthyridin-2-yl]morpholine (PubChem CID 130229064) has the molecular formula C23H20F3N5O and a molecular weight of 439.44 g/mol. Its IUPAC name is (3R)-3-methyl-4-[5-methyl-8-(1H-pyrazol-5-yl)-4-(2,3,5-trifluorophenyl)-1,7-naphthyridin-2-yl]morpholine.
| Compound Name | (3R)-3-methyl-4-[5-methyl-8-(1H-pyrazol-5-yl)-4-(2,3,5-trifluorophenyl)-1,7-naphthyridin-2-yl]morpholine |
|---|---|
| PubChem CID | 130229064 |
| Molecular Formula | C23H20F3N5O |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (3R)-3-methyl-4-[5-methyl-8-(1H-pyrazol-5-yl)-4-(2,3,5-trifluorophenyl)-1,7-naphthyridin-2-yl]morpholine |
| SMILES | Cc1cnc(-c2ccn[nH]2)c2nc(N3CCOC[C@H]3C)cc(-c3cc(F)cc(F)c3F)c12 |
| InChI | InChI=1S/C23H20F3N5O/c1-12-10-27-22(18-3-4-28-30-18)23-20(12)15(16-7-14(24)8-17(25)21(16)26)9-19(29-23)31-5-6-32-11-13(31)2/h3-4,7-10,13H,5-6,11H2,1-2H3,(H,28,30)/t13-/m1/s1 |
| InChIKey | MDNYGAMEFDKZMA-CYBMUJFWSA-N |
| XLogP | 4.64 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|