C24H33N3O4S — CID 130229353
4-[(4S)-2,2-dimethyloxan-4-yl]-N-(2-methoxy-7-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-c]azepin-3-yl)benzenesulfonamide (PubChem CID 130229353) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is 4-[(4S)-2,2-dimethyloxan-4-yl]-N-(2-methoxy-7-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-c]azepin-3-yl)benzenesulfonamide.
| Compound Name | 4-[(4S)-2,2-dimethyloxan-4-yl]-N-(2-methoxy-7-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-c]azepin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 130229353 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-[(4S)-2,2-dimethyloxan-4-yl]-N-(2-methoxy-7-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-c]azepin-3-yl)benzenesulfonamide |
| SMILES | COc1nc2c(cc1NS(=O)(=O)c1ccc([C@H]3CCOC(C)(C)C3)cc1)CCC(C)NC2 |
| InChI | InChI=1S/C24H33N3O4S/c1-16-5-6-18-13-21(23(30-4)26-22(18)15-25-16)27-32(28,29)20-9-7-17(8-10-20)19-11-12-31-24(2,3)14-19/h7-10,13,16,19,25,27H,5-6,11-12,14-15H2,1-4H3/t16?,19-/m0/s1 |
| InChIKey | IVLLOWGAEPFMQV-CVMIBEPCSA-N |
| XLogP | 3.99 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |